C19H38O4Si — CID 91535617
4-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethyl)cyclohexane-1-carboxylic acid (PubChem CID 91535617) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is 4-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91535617 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 4-tert-butyl-4-[tert-butyl(dimethyl)silyl]oxy-1-(methoxymethyl)cyclohexane-1-carboxylic acid |
| SMILES | COCC1(C(=O)O)CCC(O[Si](C)(C)C(C)(C)C)(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H38O4Si/c1-16(2,3)19(23-24(8,9)17(4,5)6)12-10-18(11-13-19,14-22-7)15(20)21/h10-14H2,1-9H3,(H,20,21) |
| InChIKey | MQKGBCISZPSZDN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|