About 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene
1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene (PubChem CID 91535751) has the molecular formula C6H5N3
and a molecular weight of 119.13 g/mol. Its IUPAC name is 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene.
Analyze 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene?
The IUPAC name of 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene (CID 91535751) is 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene.
What is the SMILES notation for 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene?
The canonical SMILES for 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene is C1=CC2(C=N1)N=CC=N2.
What is the InChIKey of 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene?
The InChIKey is VYTBFEFBKGFADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3/c1-2-7-5-6(1)8-3-4-9-6/h1-5H.
What are the key properties of 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene?
1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene has a molecular weight of 119.13 g/mol, XLogP of 0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,7-triazaspiro[4.4]nona-1,3,6,8-tetraene is sourced from PubChem (CID 91535751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).