About 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid
3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid (PubChem CID 91536207) has the molecular formula C13H13FN2O3
and a molecular weight of 264.26 g/mol. Its IUPAC name is 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid |
| PubChem CID | 91536207 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid |
| SMILES | Cc1[nH]c2c(F)ccc(C)c2c1C(C(N)=O)C(=O)O |
| InChI | InChI=1S/C13H13FN2O3/c1-5-3-4-7(14)11-8(5)9(6(2)16-11)10(12(15)17)13(18)19/h3-4,10,16H,1-2H3,(H2,15,17)(H,18,19) |
| InChIKey | ZNAAMCJYNOKYQK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid?
The IUPAC name of 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid (CID 91536207) is 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid.
What is the SMILES notation for 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid?
The canonical SMILES for 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid is Cc1[nH]c2c(F)ccc(C)c2c1C(C(N)=O)C(=O)O.
What is the InChIKey of 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid?
The InChIKey is ZNAAMCJYNOKYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O3/c1-5-3-4-7(14)11-8(5)9(6(2)16-11)10(12(15)17)13(18)19/h3-4,10,16H,1-2H3,(H2,15,17)(H,18,19).
What are the key properties of 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid?
3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid has a molecular weight of 264.26 g/mol, XLogP of 1.58, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(7-fluoro-2,4-dimethyl-1H-indol-3-yl)-3-oxopropanoic acid is sourced from PubChem (CID 91536207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).