C19H21ClN2O2S — CID 9153625
2-chloro-N-[(2S)-3-methyl-1-(4-methylsulfanylanilino)-1-oxobutan-2-yl]benzamide (PubChem CID 9153625) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-3-methyl-1-(4-methylsulfanylanilino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(2S)-3-methyl-1-(4-methylsulfanylanilino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 9153625 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-chloro-N-[(2S)-3-methyl-1-(4-methylsulfanylanilino)-1-oxobutan-2-yl]benzamide |
| SMILES | CSc1ccc(NC(=O)[C@@H](NC(=O)c2ccccc2Cl)C(C)C)cc1 |
| InChI | InChI=1S/C19H21ClN2O2S/c1-12(2)17(22-18(23)15-6-4-5-7-16(15)20)19(24)21-13-8-10-14(25-3)11-9-13/h4-12,17H,1-3H3,(H,21,24)(H,22,23)/t17-/m0/s1 |
| InChIKey | RRVKQYJUEXCMES-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |