C10H9F2NO2 — CID 91537013
2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one (PubChem CID 91537013) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one.
| Compound Name | 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 91537013 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one |
| SMILES | CCN1C(=O)c2cc(F)c(F)cc2C1O |
| InChI | InChI=1S/C10H9F2NO2/c1-2-13-9(14)5-3-7(11)8(12)4-6(5)10(13)15/h3-4,9,14H,2H2,1H3 |
| InChIKey | WVEBCCHIMVCZJJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |