About 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one
2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one (PubChem CID 91537013) has the molecular formula C10H9F2NO2
and a molecular weight of 213.18 g/mol. Its IUPAC name is 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one |
| PubChem CID | 91537013 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one |
| SMILES | CCN1C(=O)c2cc(F)c(F)cc2C1O |
| InChI | InChI=1S/C10H9F2NO2/c1-2-13-9(14)5-3-7(11)8(12)4-6(5)10(13)15/h3-4,9,14H,2H2,1H3 |
| InChIKey | WVEBCCHIMVCZJJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one?
The IUPAC name of 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one (CID 91537013) is 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one.
What is the SMILES notation for 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one?
The canonical SMILES for 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one is CCN1C(=O)c2cc(F)c(F)cc2C1O.
What is the InChIKey of 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one?
The InChIKey is WVEBCCHIMVCZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO2/c1-2-13-9(14)5-3-7(11)8(12)4-6(5)10(13)15/h3-4,9,14H,2H2,1H3.
What are the key properties of 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one?
2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one has a molecular weight of 213.18 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-difluoro-3-hydroxy-3H-isoindol-1-one is sourced from PubChem (CID 91537013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).