C33H35N5S — CID 91537053
3-[2-[[4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methylamino]ethyl]benzenethiol (PubChem CID 91537053) has the molecular formula C33H35N5S and a molecular weight of 533.75 g/mol. Its IUPAC name is 3-[2-[[4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methylamino]ethyl]benzenethiol.
| Compound Name | 3-[2-[[4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methylamino]ethyl]benzenethiol |
|---|---|
| PubChem CID | 91537053 |
| Molecular Formula | C33H35N5S |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 3-[2-[[4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methylamino]ethyl]benzenethiol |
| SMILES | Sc1cccc(CCNCc2ccc(CN(Cc3nc4ccccc4[nH]3)C3CCCc4cccnc43)cc2)c1 |
| InChI | InChI=1S/C33H35N5S/c39-28-9-3-6-24(20-28)17-19-34-21-25-13-15-26(16-14-25)22-38(23-32-36-29-10-1-2-11-30(29)37-32)31-12-4-7-27-8-5-18-35-33(27)31/h1-3,5-6,8-11,13-16,18,20,31,34,39H,4,7,12,17,19,21-23H2,(H,36,37) |
| InChIKey | XSCJRWPTYYKUGB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|