C17H17N5O8 — CID 91537079
12-[4,5-dihydroxy-2-(hydroxyamino)-3-oxopentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione (PubChem CID 91537079) has the molecular formula C17H17N5O8 and a molecular weight of 419.35 g/mol. Its IUPAC name is 12-[4,5-dihydroxy-2-(hydroxyamino)-3-oxopentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione.
| Compound Name | 12-[4,5-dihydroxy-2-(hydroxyamino)-3-oxopentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91537079 |
| Molecular Formula | C17H17N5O8 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 12-[4,5-dihydroxy-2-(hydroxyamino)-3-oxopentyl]-8,9-dihydro-[1,4]benzodioxino[6,7-g]pteridine-2,4-dione |
| SMILES | O=C(C(O)CO)C(Cn1c2nc(=O)[nH]c(=O)c-2nc2cc3c(cc21)OCCO3)NO |
| InChI | InChI=1S/C17H17N5O8/c23-6-10(24)14(25)8(21-28)5-22-9-4-12-11(29-1-2-30-12)3-7(9)18-13-15(22)19-17(27)20-16(13)26/h3-4,8,10,21,23-24,28H,1-2,5-6H2,(H,20,26,27) |
| InChIKey | VYLNQMHWACWOCX-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|