C28H28FN5O8 — CID 91537153
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pyridin-3-ylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91537153) has the molecular formula C28H28FN5O8 and a molecular weight of 581.56 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pyridin-3-ylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pyridin-3-ylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91537153 |
| Molecular Formula | C28H28FN5O8 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(pyridin-3-ylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(NC(=O)CNc5cccnc5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H28FN5O8/c1-34(2)21-14-7-11-6-13-15(29)8-16(33-17(35)10-32-12-4-3-5-31-9-12)22(36)19(13)23(37)18(11)25(39)28(14,42)26(40)20(24(21)38)27(30)41/h3-5,8-9,11,14,18,20-21,32,36,42H,6-7,10H2,1-2H3,(H2,30,41)(H,33,35)/t11-,14-,18?,20?,21-,28-/m0/s1 |
| InChIKey | VJNBQKYSXGZHSP-GGZVDGLUSA-N |
| XLogP | -0.55 |
| TPSA | 209.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|