C22H18F5NO8S — CID 91537506
(4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91537506) has the molecular formula C22H18F5NO8S and a molecular weight of 551.44 g/mol. Its IUPAC name is (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91537506 |
| Molecular Formula | C22H18F5NO8S |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | (4aR,5S,5aS,6R,12aS)-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-6-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@H]3C(C(=O)c4c(O)cccc4[C@@H]3CSC(F)(F)C(F)(F)F)C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C22H18F5NO8S/c23-21(24,25)22(26,27)37-5-7-6-2-1-3-9(29)11(6)16(32)14-12(7)15(31)8-4-10(30)13(19(28)35)17(33)20(8,36)18(14)34/h1-3,7-8,12-15,29,31,36H,4-5H2,(H2,28,35)/t7-,8+,12+,13?,14?,15+,20+/m0/s1 |
| InChIKey | KNUUZFGGWKBYAF-JHFHGYHYSA-N |
| XLogP | 0.73 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|