About [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate
[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate (PubChem CID 91537600) has the molecular formula C13H26O3S
and a molecular weight of 262.41 g/mol. Its IUPAC name is [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate.
Molecular Properties
| Compound Name | [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate |
| PubChem CID | 91537600 |
| Molecular Formula | C13H26O3S |
| Molecular Weight | 262.41 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate |
| SMILES | CCC(C)(C)OCCC(C)(C)OC(=O)CSC |
| InChI | InChI=1S/C13H26O3S/c1-7-12(2,3)15-9-8-13(4,5)16-11(14)10-17-6/h7-10H2,1-6H3 |
| InChIKey | FLWBUWREIVYVQJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate?
The IUPAC name of [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate (CID 91537600) is [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate.
What is the SMILES notation for [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate?
The canonical SMILES for [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate is CCC(C)(C)OCCC(C)(C)OC(=O)CSC.
What is the InChIKey of [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate?
The InChIKey is FLWBUWREIVYVQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3S/c1-7-12(2,3)15-9-8-13(4,5)16-11(14)10-17-6/h7-10H2,1-6H3.
What are the key properties of [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate?
[2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate has a molecular weight of 262.41 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4-(2-methylbutan-2-yloxy)butan-2-yl] 2-methylsulfanylacetate is sourced from PubChem (CID 91537600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).