C9H22N2O — CID 91538543
1-methoxy-N,N-dimethylethanamine;pyrrolidine (PubChem CID 91538543) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethylethanamine;pyrrolidine.
| Compound Name | 1-methoxy-N,N-dimethylethanamine;pyrrolidine |
|---|---|
| PubChem CID | 91538543 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 1-methoxy-N,N-dimethylethanamine;pyrrolidine |
| SMILES | C1CCNC1.COC(C)N(C)C |
| InChI | InChI=1S/C5H13NO.C4H9N/c1-5(7-4)6(2)3;1-2-4-5-3-1/h5H,1-4H3;5H,1-4H2 |
| InChIKey | KDOYJCWXXZGPET-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|