C26H27Cl2N5O4 — CID 91538711
dichloromethane;N-[1-[2-[[2-(dimethylamino)acetyl]-methylamino]acetyl]indol-6-yl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 91538711) has the molecular formula C26H27Cl2N5O4 and a molecular weight of 544.44 g/mol. Its IUPAC name is dichloromethane;N-[1-[2-[[2-(dimethylamino)acetyl]-methylamino]acetyl]indol-6-yl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | dichloromethane;N-[1-[2-[[2-(dimethylamino)acetyl]-methylamino]acetyl]indol-6-yl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 91538711 |
| Molecular Formula | C26H27Cl2N5O4 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | dichloromethane;N-[1-[2-[[2-(dimethylamino)acetyl]-methylamino]acetyl]indol-6-yl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CN(C)CC(=O)N(C)CC(=O)n1ccc2ccc(NC(=O)c3c[nH]c4ccccc4c3=O)cc21.ClCCl |
| InChI | InChI=1S/C25H25N5O4.CH2Cl2/c1-28(2)14-22(31)29(3)15-23(32)30-11-10-16-8-9-17(12-21(16)30)27-25(34)19-13-26-20-7-5-4-6-18(20)24(19)33;2-1-3/h4-13H,14-15H2,1-3H3,(H,26,33)(H,27,34);1H2 |
| InChIKey | OJNLNXBRJQPNEB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|