C22H28N4O5 — CID 91539017
3-[[4-[2-(1,3-diazinan-1-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoic acid (PubChem CID 91539017) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-[[4-[2-(1,3-diazinan-1-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[4-[2-(1,3-diazinan-1-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 91539017 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 3-[[4-[2-(1,3-diazinan-1-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(OCCNN2CCCNC2)cc1O)c1ccccc1 |
| InChI | InChI=1S/C22H28N4O5/c27-20-13-17(31-12-10-24-26-11-4-9-23-15-26)7-8-18(20)22(30)25-19(14-21(28)29)16-5-2-1-3-6-16/h1-3,5-8,13,19,23-24,27H,4,9-12,14-15H2,(H,25,30)(H,28,29) |
| InChIKey | RKNQRZGVFXEQJU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|