About 1-(ethylideneamino)-N,N-dimethylpentan-2-amine
1-(ethylideneamino)-N,N-dimethylpentan-2-amine (PubChem CID 91539104) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-(ethylideneamino)-N,N-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 1-(ethylideneamino)-N,N-dimethylpentan-2-amine |
| PubChem CID | 91539104 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-(ethylideneamino)-N,N-dimethylpentan-2-amine |
| SMILES | C/C=N/CC(CCC)N(C)C |
| InChI | InChI=1S/C9H20N2/c1-5-7-9(11(3)4)8-10-6-2/h6,9H,5,7-8H2,1-4H3/b10-6+ |
| InChIKey | VXEWCDKCOBYXAY-UXBLZVDNSA-N |
| XLogP | 1.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylideneamino)-N,N-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylideneamino)-N,N-dimethylpentan-2-amine?
The IUPAC name of 1-(ethylideneamino)-N,N-dimethylpentan-2-amine (CID 91539104) is 1-(ethylideneamino)-N,N-dimethylpentan-2-amine.
What is the SMILES notation for 1-(ethylideneamino)-N,N-dimethylpentan-2-amine?
The canonical SMILES for 1-(ethylideneamino)-N,N-dimethylpentan-2-amine is C/C=N/CC(CCC)N(C)C.
What is the InChIKey of 1-(ethylideneamino)-N,N-dimethylpentan-2-amine?
The InChIKey is VXEWCDKCOBYXAY-UXBLZVDNSA-N. The full InChI is InChI=1S/C9H20N2/c1-5-7-9(11(3)4)8-10-6-2/h6,9H,5,7-8H2,1-4H3/b10-6+.
What are the key properties of 1-(ethylideneamino)-N,N-dimethylpentan-2-amine?
1-(ethylideneamino)-N,N-dimethylpentan-2-amine has a molecular weight of 156.27 g/mol, XLogP of 1.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylideneamino)-N,N-dimethylpentan-2-amine is sourced from PubChem (CID 91539104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).