C17H26O5Si — CID 91539150
2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetic acid (PubChem CID 91539150) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetic acid.
| Compound Name | 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetic acid |
|---|---|
| PubChem CID | 91539150 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[[(4S,5R)-2,2-dimethyl-5-(6-trimethylsilylhexa-1,3-dien-5-ynyl)-1,3-dioxolan-4-yl]methoxy]acetic acid |
| SMILES | CC1(C)O[C@@H](COCC(=O)O)[C@@H](C=CC=CC#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H26O5Si/c1-17(2)21-14(15(22-17)12-20-13-16(18)19)10-8-6-7-9-11-23(3,4)5/h6-8,10,14-15H,12-13H2,1-5H3,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | MMFDCCYPTJYTCB-CABCVRRESA-N |
| XLogP | 2.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|