C21H20N4O4S — CID 91539554
(5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(methylaminomethyl)thiophen-2-yl]ethynyl]imidazolidine-2,4-dione (PubChem CID 91539554) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(methylaminomethyl)thiophen-2-yl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(methylaminomethyl)thiophen-2-yl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91539554 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (5R)-5-[(1-hydroxy-6-methoxyisoindol-2-yl)methyl]-5-[2-[5-(methylaminomethyl)thiophen-2-yl]ethynyl]imidazolidine-2,4-dione |
| SMILES | CNCc1ccc(C#C[C@]2(Cn3cc4ccc(OC)cc4c3O)NC(=O)NC2=O)s1 |
| InChI | InChI=1S/C21H20N4O4S/c1-22-10-16-6-5-15(30-16)7-8-21(19(27)23-20(28)24-21)12-25-11-13-3-4-14(29-2)9-17(13)18(25)26/h3-6,9,11,22,26H,10,12H2,1-2H3,(H2,23,24,27,28)/t21-/m1/s1 |
| InChIKey | CDXAMWRLGYSQQZ-OAQYLSRUSA-N |
| XLogP | 1.77 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|