About 1,3-diisocyanatopent-1-ene
1,3-diisocyanatopent-1-ene (PubChem CID 91539677) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 1,3-diisocyanatopent-1-ene.
Molecular Properties
| Compound Name | 1,3-diisocyanatopent-1-ene |
| PubChem CID | 91539677 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 1,3-diisocyanatopent-1-ene |
| SMILES | CCC(C=CN=C=O)N=C=O |
| InChI | InChI=1S/C7H8N2O2/c1-2-7(9-6-11)3-4-8-5-10/h3-4,7H,2H2,1H3 |
| InChIKey | SEACZZMAXKOIBU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diisocyanatopent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diisocyanatopent-1-ene?
The IUPAC name of 1,3-diisocyanatopent-1-ene (CID 91539677) is 1,3-diisocyanatopent-1-ene.
What is the SMILES notation for 1,3-diisocyanatopent-1-ene?
The canonical SMILES for 1,3-diisocyanatopent-1-ene is CCC(C=CN=C=O)N=C=O.
What is the InChIKey of 1,3-diisocyanatopent-1-ene?
The InChIKey is SEACZZMAXKOIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-2-7(9-6-11)3-4-8-5-10/h3-4,7H,2H2,1H3.
What are the key properties of 1,3-diisocyanatopent-1-ene?
1,3-diisocyanatopent-1-ene has a molecular weight of 152.15 g/mol, XLogP of 0.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diisocyanatopent-1-ene is sourced from PubChem (CID 91539677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).