About N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid
N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid (PubChem CID 91539702) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid.
Molecular Properties
| Compound Name | N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid |
| PubChem CID | 91539702 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid |
| SMILES | CC(C)N1CC(C(=O)O)C1.CNOC |
| InChI | InChI=1S/C7H13NO2.C2H7NO/c1-5(2)8-3-6(4-8)7(9)10;1-3-4-2/h5-6H,3-4H2,1-2H3,(H,9,10);3H,1-2H3 |
| InChIKey | PLHMMMXPNBVOJC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid?
The IUPAC name of N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid (CID 91539702) is N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid.
What is the SMILES notation for N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid?
The canonical SMILES for N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid is CC(C)N1CC(C(=O)O)C1.CNOC.
What is the InChIKey of N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid?
The InChIKey is PLHMMMXPNBVOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C2H7NO/c1-5(2)8-3-6(4-8)7(9)10;1-3-4-2/h5-6H,3-4H2,1-2H3,(H,9,10);3H,1-2H3.
What are the key properties of N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid?
N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid has a molecular weight of 204.27 g/mol, XLogP of 0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxymethanamine;1-propan-2-ylazetidine-3-carboxylic acid is sourced from PubChem (CID 91539702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).