C38H32N2O2 — CID 91539768
2-cyano-2-[3-[2-[1-(3,5-diphenylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid (PubChem CID 91539768) has the molecular formula C38H32N2O2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-cyano-2-[3-[2-[1-(3,5-diphenylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid.
| Compound Name | 2-cyano-2-[3-[2-[1-(3,5-diphenylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
|---|---|
| PubChem CID | 91539768 |
| Molecular Formula | C38H32N2O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 2-cyano-2-[3-[2-[1-(3,5-diphenylphenyl)-3,4-dihydro-2H-quinolin-6-yl]ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
| SMILES | N#CC(C(=O)O)=C1C=C(C=Cc2ccc3c(c2)CCCN3c2cc(-c3ccccc3)cc(-c3ccccc3)c2)CCC1 |
| InChI | InChI=1S/C38H32N2O2/c39-26-36(38(41)42)31-14-7-9-27(21-31)16-17-28-18-19-37-32(22-28)15-8-20-40(37)35-24-33(29-10-3-1-4-11-29)23-34(25-35)30-12-5-2-6-13-30/h1-6,10-13,16-19,21-25H,7-9,14-15,20H2,(H,41,42) |
| InChIKey | HJRUBLNTCIAIOC-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|