C11H11FN2O4 — CID 91539862
[2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]carbamic acid (PubChem CID 91539862) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is [2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]carbamic acid.
| Compound Name | [2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 91539862 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [2-fluoro-4-(3-oxomorpholin-4-yl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(N2CCOCC2=O)cc1F |
| InChI | InChI=1S/C11H11FN2O4/c12-8-5-7(1-2-9(8)13-11(16)17)14-3-4-18-6-10(14)15/h1-2,5,13H,3-4,6H2,(H,16,17) |
| InChIKey | DNENTQJWGXSVKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |