C23H38N2O2 — CID 91539963
ethane;(7E)-1,3,4-trimethyl-7-[(2Z)-penta-2,4-dienylidene]-3,8-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 91539963) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethane;(7E)-1,3,4-trimethyl-7-[(2Z)-penta-2,4-dienylidene]-3,8-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | ethane;(7E)-1,3,4-trimethyl-7-[(2Z)-penta-2,4-dienylidene]-3,8-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 91539963 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | ethane;(7E)-1,3,4-trimethyl-7-[(2Z)-penta-2,4-dienylidene]-3,8-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | C=C/C=C\C=C1\C=C2C(=O)N(C)C(C)C(=O)N(C)C2=CC1.CC.CC.CC |
| InChI | InChI=1S/C17H20N2O2.3C2H6/c1-5-6-7-8-13-9-10-15-14(11-13)17(21)18(3)12(2)16(20)19(15)4;3*1-2/h5-8,10-12H,1,9H2,2-4H3;3*1-2H3/b7-6-,13-8+;;; |
| InChIKey | AKOJQEDVSRMQEF-JOHVJXEKSA-N |
| XLogP | 5.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|