About N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide
N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide (PubChem CID 91540059) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide |
| PubChem CID | 91540059 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide |
| SMILES | Cc1ncnc(NC(=O)C(C)C)c1C |
| InChI | InChI=1S/C10H15N3O/c1-6(2)10(14)13-9-7(3)8(4)11-5-12-9/h5-6H,1-4H3,(H,11,12,13,14) |
| InChIKey | ZZXTUVXWDHXORH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide?
The IUPAC name of N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide (CID 91540059) is N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide.
What is the SMILES notation for N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide?
The canonical SMILES for N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide is Cc1ncnc(NC(=O)C(C)C)c1C.
What is the InChIKey of N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide?
The InChIKey is ZZXTUVXWDHXORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c1-6(2)10(14)13-9-7(3)8(4)11-5-12-9/h5-6H,1-4H3,(H,11,12,13,14).
What are the key properties of N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide?
N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide has a molecular weight of 193.25 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dimethylpyrimidin-4-yl)-2-methylpropanamide is sourced from PubChem (CID 91540059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).