About 5-ethoxy-1,2-dimethylbenzimidazole
5-ethoxy-1,2-dimethylbenzimidazole (PubChem CID 915403) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-ethoxy-1,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 5-ethoxy-1,2-dimethylbenzimidazole |
| PubChem CID | 915403 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 5-ethoxy-1,2-dimethylbenzimidazole |
| SMILES | CCOc1ccc2c(c1)nc(C)n2C |
| InChI | InChI=1S/C11H14N2O/c1-4-14-9-5-6-11-10(7-9)12-8(2)13(11)3/h5-7H,4H2,1-3H3 |
| InChIKey | YDZOOJXJCJIWRF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethoxy-1,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1,2-dimethylbenzimidazole?
The IUPAC name of 5-ethoxy-1,2-dimethylbenzimidazole (CID 915403) is 5-ethoxy-1,2-dimethylbenzimidazole.
What is the SMILES notation for 5-ethoxy-1,2-dimethylbenzimidazole?
The canonical SMILES for 5-ethoxy-1,2-dimethylbenzimidazole is CCOc1ccc2c(c1)nc(C)n2C.
What is the InChIKey of 5-ethoxy-1,2-dimethylbenzimidazole?
The InChIKey is YDZOOJXJCJIWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-4-14-9-5-6-11-10(7-9)12-8(2)13(11)3/h5-7H,4H2,1-3H3.
What are the key properties of 5-ethoxy-1,2-dimethylbenzimidazole?
5-ethoxy-1,2-dimethylbenzimidazole has a molecular weight of 190.25 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1,2-dimethylbenzimidazole is sourced from PubChem (CID 915403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).