About 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid
6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid (PubChem CID 91540449) has the molecular formula C12H21F2NO4
and a molecular weight of 281.30 g/mol. Its IUPAC name is 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid |
| PubChem CID | 91540449 |
| Molecular Formula | C12H21F2NO4 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid |
| SMILES | CCN(CC)CC1OC(F)(C(=O)O)C(F)C(O)C1C |
| InChI | InChI=1S/C12H21F2NO4/c1-4-15(5-2)6-8-7(3)9(16)10(13)12(14,19-8)11(17)18/h7-10,16H,4-6H2,1-3H3,(H,17,18) |
| InChIKey | JZYSRVUXFMMZRW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid?
The IUPAC name of 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid (CID 91540449) is 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid.
What is the SMILES notation for 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid?
The canonical SMILES for 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid is CCN(CC)CC1OC(F)(C(=O)O)C(F)C(O)C1C.
What is the InChIKey of 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid?
The InChIKey is JZYSRVUXFMMZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO4/c1-4-15(5-2)6-8-7(3)9(16)10(13)12(14,19-8)11(17)18/h7-10,16H,4-6H2,1-3H3,(H,17,18).
What are the key properties of 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid?
6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid has a molecular weight of 281.30 g/mol, XLogP of 0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(diethylaminomethyl)-2,3-difluoro-4-hydroxy-5-methyloxane-2-carboxylic acid is sourced from PubChem (CID 91540449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).