About oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate
oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate (PubChem CID 91540458) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate.
Molecular Properties
| Compound Name | oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate |
| PubChem CID | 91540458 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate |
| SMILES | [H]/N=C(\C(CC)CC)C(C#N)C(=O)OC1COC1 |
| InChI | InChI=1S/C12H18N2O3/c1-3-8(4-2)11(14)10(5-13)12(15)17-9-6-16-7-9/h8-10,14H,3-4,6-7H2,1-2H3/b14-11+ |
| InChIKey | GKWRIVZXOLXWNT-SDNWHVSQSA-N |
| XLogP | 1.52 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate?
The IUPAC name of oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate (CID 91540458) is oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate.
What is the SMILES notation for oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate?
The canonical SMILES for oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate is [H]/N=C(\C(CC)CC)C(C#N)C(=O)OC1COC1.
What is the InChIKey of oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate?
The InChIKey is GKWRIVZXOLXWNT-SDNWHVSQSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-3-8(4-2)11(14)10(5-13)12(15)17-9-6-16-7-9/h8-10,14H,3-4,6-7H2,1-2H3/b14-11+.
What are the key properties of oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate?
oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate has a molecular weight of 238.29 g/mol, XLogP of 1.52, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxetan-3-yl 2-cyano-4-ethyl-3-iminohexanoate is sourced from PubChem (CID 91540458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).