About 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate
4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate (PubChem CID 91540464) has the molecular formula C20H28N2O8
and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate.
Molecular Properties
| Compound Name | 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate |
| PubChem CID | 91540464 |
| Molecular Formula | C20H28N2O8 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate |
| SMILES | COC(=O)COCNc1ccc(O)cc1.COCOCOCNc1ccc(O)cc1 |
| InChI | InChI=1S/C10H15NO4.C10H13NO4/c1-13-7-15-8-14-6-11-9-2-4-10(12)5-3-9;1-14-10(13)6-15-7-11-8-2-4-9(12)5-3-8/h2-5,11-12H,6-8H2,1H3;2-5,11-12H,6-7H2,1H3 |
| InChIKey | ORXYHLGIDDQGCL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate?
The IUPAC name of 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate (CID 91540464) is 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate.
What is the SMILES notation for 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate?
The canonical SMILES for 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate is COC(=O)COCNc1ccc(O)cc1.COCOCOCNc1ccc(O)cc1.
What is the InChIKey of 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate?
The InChIKey is ORXYHLGIDDQGCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4.C10H13NO4/c1-13-7-15-8-14-6-11-9-2-4-10(12)5-3-9;1-14-10(13)6-15-7-11-8-2-4-9(12)5-3-8/h2-5,11-12H,6-8H2,1H3;2-5,11-12H,6-7H2,1H3.
What are the key properties of 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate?
4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate has a molecular weight of 424.45 g/mol, XLogP of 2.31, 12 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethoxymethoxymethylamino)phenol;methyl 2-[(4-hydroxyanilino)methoxy]acetate is sourced from PubChem (CID 91540464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).