C16H21NO3 — CID 91540736
8-(2-methylpropyl)-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol (PubChem CID 91540736) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 8-(2-methylpropyl)-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol.
| Compound Name | 8-(2-methylpropyl)-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 91540736 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 8-(2-methylpropyl)-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undeca-2,5-diene-3,5-diol |
| SMILES | C=CCn1c(O)c2c(c1O)C1CC2C2OC12CC(C)C |
| InChI | InChI=1S/C16H21NO3/c1-4-5-17-14(18)11-9-6-10(12(11)15(17)19)16(7-8(2)3)13(9)20-16/h4,8-10,13,18-19H,1,5-7H2,2-3H3 |
| InChIKey | AIXJPWDHZIFNRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|