About 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole
3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole (PubChem CID 91541039) has the molecular formula C22H17ClF2N2O2
and a molecular weight of 414.84 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole |
| PubChem CID | 91541039 |
| Molecular Formula | C22H17ClF2N2O2 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole |
| SMILES | CCCOc1cc(Oc2ccc(F)cc2F)cc2[nH]nc(-c3ccccc3Cl)c12 |
| InChI | InChI=1S/C22H17ClF2N2O2/c1-2-9-28-20-12-14(29-19-8-7-13(24)10-17(19)25)11-18-21(20)22(27-26-18)15-5-3-4-6-16(15)23/h3-8,10-12H,2,9H2,1H3,(H,26,27) |
| InChIKey | SLRHSNMQFGUURX-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole?
The IUPAC name of 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole (CID 91541039) is 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole.
What is the SMILES notation for 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole?
The canonical SMILES for 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole is CCCOc1cc(Oc2ccc(F)cc2F)cc2[nH]nc(-c3ccccc3Cl)c12.
What is the InChIKey of 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole?
The InChIKey is SLRHSNMQFGUURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClF2N2O2/c1-2-9-28-20-12-14(29-19-8-7-13(24)10-17(19)25)11-18-21(20)22(27-26-18)15-5-3-4-6-16(15)23/h3-8,10-12H,2,9H2,1H3,(H,26,27).
What are the key properties of 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole?
3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole has a molecular weight of 414.84 g/mol, XLogP of 6.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-6-(2,4-difluorophenoxy)-4-propoxy-1H-indazole is sourced from PubChem (CID 91541039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).