C18H22N5O2+ — CID 91541398
2-[[3-[(4,6-dioxocyclohex-2-en-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium (PubChem CID 91541398) has the molecular formula C18H22N5O2+ and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[[3-[(4,6-dioxocyclohex-2-en-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[3-[(4,6-dioxocyclohex-2-en-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 91541398 |
| Molecular Formula | C18H22N5O2+ |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-[[3-[(4,6-dioxocyclohex-2-en-1-ylidene)amino]pyrazolo[1,5-a]pyridin-2-yl]amino]ethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCNc1nn2ccccc2c1/N=C1\C=CC(=O)CC1=O |
| InChI | InChI=1S/C18H22N5O2/c1-23(2,3)11-9-19-18-17(15-6-4-5-10-22(15)21-18)20-14-8-7-13(24)12-16(14)25/h4-8,10H,9,11-12H2,1-3H3,(H,19,21)/q+1/b20-14+ |
| InChIKey | XEGXNNHTYMFGAM-XSFVSMFZSA-N |
| XLogP | 1.62 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|