C20H13ClF7N5O2 — CID 91541615
6-chloro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine (PubChem CID 91541615) has the molecular formula C20H13ClF7N5O2 and a molecular weight of 523.80 g/mol. Its IUPAC name is 6-chloro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91541615 |
| Molecular Formula | C20H13ClF7N5O2 |
| Molecular Weight | 523.80 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 6-chloro-N-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-[[4-(trifluoromethoxy)phenyl]methyldiazenyl]pyrimidin-4-amine |
| SMILES | FC(F)C(F)(F)Oc1ccc(Nc2cc(Cl)nc(/N=N/Cc3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H13ClF7N5O2/c21-15-9-16(30-12-3-7-13(8-4-12)34-19(24,25)17(22)23)32-18(31-15)33-29-10-11-1-5-14(6-2-11)35-20(26,27)28/h1-9,17H,10H2,(H,30,31,32)/b33-29+ |
| InChIKey | YMBTXQSZGWOJBQ-XPXRSFDGSA-N |
| XLogP | 7.29 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.80 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|