C59H108O8 — CID 91541744
[18,20-dioxo-19-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]heptatriaconta-9,28-dien-19-yl] octadec-9-enoate (PubChem CID 91541744) has the molecular formula C59H108O8 and a molecular weight of 945.50 g/mol. Its IUPAC name is [18,20-dioxo-19-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]heptatriaconta-9,28-dien-19-yl] octadec-9-enoate.
| Compound Name | [18,20-dioxo-19-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]heptatriaconta-9,28-dien-19-yl] octadec-9-enoate |
|---|---|
| PubChem CID | 91541744 |
| Molecular Formula | C59H108O8 |
| Molecular Weight | 945.50 g/mol |
| Exact Mass | 944.80 |
| IUPAC Name | [18,20-dioxo-19-[(1R,2S,3R)-1,2,3,4-tetrahydroxybutyl]heptatriaconta-9,28-dien-19-yl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(C(=O)CCCCCCCC=CCCCCCCCC)(C(=O)CCCCCCCC=CCCCCCCCC)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C59H108O8/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-54(62)59(58(66)57(65)53(61)52-60,55(63)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)67-56(64)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h25-30,53,57-58,60-61,65-66H,4-24,31-52H2,1-3H3/t53-,57+,58-,59?/m1/s1 |
| InChIKey | YKEHAPSOPHXYES-GDYSOXQCSA-N |
| XLogP | 15.59 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.50 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|