About 4-fluorobut-1-ene-1,3-dione
4-fluorobut-1-ene-1,3-dione (PubChem CID 91542000) has the molecular formula C4H3FO2
and a molecular weight of 102.06 g/mol. Its IUPAC name is 4-fluorobut-1-ene-1,3-dione.
Molecular Properties
| Compound Name | 4-fluorobut-1-ene-1,3-dione |
| PubChem CID | 91542000 |
| Molecular Formula | C4H3FO2 |
| Molecular Weight | 102.06 g/mol |
| Exact Mass | 102.01 |
| IUPAC Name | 4-fluorobut-1-ene-1,3-dione |
| SMILES | O=C=CC(=O)CF |
| InChI | InChI=1S/C4H3FO2/c5-3-4(7)1-2-6/h1H,3H2 |
| InChIKey | NDMPMXJSLKOHLA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.06 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobut-1-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobut-1-ene-1,3-dione?
The IUPAC name of 4-fluorobut-1-ene-1,3-dione (CID 91542000) is 4-fluorobut-1-ene-1,3-dione.
What is the SMILES notation for 4-fluorobut-1-ene-1,3-dione?
The canonical SMILES for 4-fluorobut-1-ene-1,3-dione is O=C=CC(=O)CF.
What is the InChIKey of 4-fluorobut-1-ene-1,3-dione?
The InChIKey is NDMPMXJSLKOHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FO2/c5-3-4(7)1-2-6/h1H,3H2.
What are the key properties of 4-fluorobut-1-ene-1,3-dione?
4-fluorobut-1-ene-1,3-dione has a molecular weight of 102.06 g/mol, XLogP of -0.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobut-1-ene-1,3-dione is sourced from PubChem (CID 91542000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).