C27H23Cl2N5O2S — CID 91542066
N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxamide (PubChem CID 91542066) has the molecular formula C27H23Cl2N5O2S and a molecular weight of 552.49 g/mol. Its IUPAC name is N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxamide.
| Compound Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 91542066 |
| Molecular Formula | C27H23Cl2N5O2S |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-1-[[5-(5-chlorothiophen-2-yl)-1,2-oxazol-3-yl]methyl]indole-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccnc(Cl)c2)CC1)c1cc2ccccc2n1Cc1cc(-c2ccc(Cl)s2)on1 |
| InChI | InChI=1S/C27H23Cl2N5O2S/c28-25-15-20(7-10-30-25)33-11-8-18(9-12-33)31-27(35)22-13-17-3-1-2-4-21(17)34(22)16-19-14-23(36-32-19)24-5-6-26(29)37-24/h1-7,10,13-15,18H,8-9,11-12,16H2,(H,31,35) |
| InChIKey | NAJFMGMXJZXBNY-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|