About heptyl N,N-dimethylcarbamate
heptyl N,N-dimethylcarbamate (PubChem CID 91542338) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is heptyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | heptyl N,N-dimethylcarbamate |
| PubChem CID | 91542338 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | heptyl N,N-dimethylcarbamate |
| SMILES | CCCCCCCOC(=O)N(C)C |
| InChI | InChI=1S/C10H21NO2/c1-4-5-6-7-8-9-13-10(12)11(2)3/h4-9H2,1-3H3 |
| InChIKey | XBSCMJOMWLNTDR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl N,N-dimethylcarbamate?
The IUPAC name of heptyl N,N-dimethylcarbamate (CID 91542338) is heptyl N,N-dimethylcarbamate.
What is the SMILES notation for heptyl N,N-dimethylcarbamate?
The canonical SMILES for heptyl N,N-dimethylcarbamate is CCCCCCCOC(=O)N(C)C.
What is the InChIKey of heptyl N,N-dimethylcarbamate?
The InChIKey is XBSCMJOMWLNTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-4-5-6-7-8-9-13-10(12)11(2)3/h4-9H2,1-3H3.
What are the key properties of heptyl N,N-dimethylcarbamate?
heptyl N,N-dimethylcarbamate has a molecular weight of 187.28 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl N,N-dimethylcarbamate is sourced from PubChem (CID 91542338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).