About 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane
2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane (PubChem CID 91542343) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane.
Molecular Properties
| Compound Name | 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane |
| PubChem CID | 91542343 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane |
| SMILES | CC.CCOC(=O)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H14O4.C2H6/c1-2-16-12(15)10(11(13)14)8-9-6-4-3-5-7-9;1-2/h3-7,10H,2,8H2,1H3,(H,13,14);1-2H3 |
| InChIKey | KJOKQGSXLHMJHS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane?
The IUPAC name of 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane (CID 91542343) is 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane.
What is the SMILES notation for 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane?
The canonical SMILES for 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane is CC.CCOC(=O)C(Cc1ccccc1)C(=O)O.
What is the InChIKey of 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane?
The InChIKey is KJOKQGSXLHMJHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.C2H6/c1-2-16-12(15)10(11(13)14)8-9-6-4-3-5-7-9;1-2/h3-7,10H,2,8H2,1H3,(H,13,14);1-2H3.
What are the key properties of 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane?
2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane has a molecular weight of 252.31 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3-ethoxy-3-oxopropanoic acid;ethane is sourced from PubChem (CID 91542343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).