About 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate
2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate (PubChem CID 91542409) has the molecular formula C6H17N3O5S2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate |
| PubChem CID | 91542409 |
| Molecular Formula | C6H17N3O5S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)NCCOS(=O)(=O)N(C)C |
| InChI | InChI=1S/C6H17N3O5S2/c1-8(2)15(10,11)7-5-6-14-16(12,13)9(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | UXVUFAUVYLHMPU-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate?
The IUPAC name of 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate (CID 91542409) is 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate.
What is the SMILES notation for 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate?
The canonical SMILES for 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate is CN(C)S(=O)(=O)NCCOS(=O)(=O)N(C)C.
What is the InChIKey of 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate?
The InChIKey is UXVUFAUVYLHMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17N3O5S2/c1-8(2)15(10,11)7-5-6-14-16(12,13)9(3)4/h7H,5-6H2,1-4H3.
What are the key properties of 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate?
2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate has a molecular weight of 275.35 g/mol, XLogP of -1.79, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylsulfamoylamino)ethyl N,N-dimethylsulfamate is sourced from PubChem (CID 91542409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).