C36H48N8O6 — CID 91542732
4-[3-amino-4-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(5-aminopentanoylamino)-4-oxobutanoic acid (PubChem CID 91542732) has the molecular formula C36H48N8O6 and a molecular weight of 688.83 g/mol. Its IUPAC name is 4-[3-amino-4-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(5-aminopentanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-[3-amino-4-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(5-aminopentanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91542732 |
| Molecular Formula | C36H48N8O6 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 4-[3-amino-4-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(5-aminopentanoylamino)-4-oxobutanoic acid |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCNCC)n(CCc2ccc(C(=O)C(CC(=O)O)NC(=O)CCCCN)cc2N)c1=O |
| InChI | InChI=1S/C36H48N8O6/c1-3-18-44-35(49)32-34(41-29(42(32)20-17-39-4-2)21-24-10-6-5-7-11-24)43(36(44)50)19-15-25-13-14-26(22-27(25)38)33(48)28(23-31(46)47)40-30(45)12-8-9-16-37/h5-7,10-11,13-14,22,28,39H,3-4,8-9,12,15-21,23,37-38H2,1-2H3,(H,40,45)(H,46,47) |
| InChIKey | NKSJRFYBKQWXLS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 209.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|