C36H64O14 — CID 91543236
[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2,3-bis(6-methylheptanoyl)-2-[(2R,3S,4S,5R)-3,4,5-trihydroxy-2,5-bis(hydroxymethyl)oxolan-3-yl]oxan-3-yl] 6-methylheptanoate (PubChem CID 91543236) has the molecular formula C36H64O14 and a molecular weight of 720.89 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2,3-bis(6-methylheptanoyl)-2-[(2R,3S,4S,5R)-3,4,5-trihydroxy-2,5-bis(hydroxymethyl)oxolan-3-yl]oxan-3-yl] 6-methylheptanoate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2,3-bis(6-methylheptanoyl)-2-[(2R,3S,4S,5R)-3,4,5-trihydroxy-2,5-bis(hydroxymethyl)oxolan-3-yl]oxan-3-yl] 6-methylheptanoate |
|---|---|
| PubChem CID | 91543236 |
| Molecular Formula | C36H64O14 |
| Molecular Weight | 720.89 g/mol |
| Exact Mass | 720.43 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2,3-bis(6-methylheptanoyl)-2-[(2R,3S,4S,5R)-3,4,5-trihydroxy-2,5-bis(hydroxymethyl)oxolan-3-yl]oxan-3-yl] 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)O[C@]1(C(=O)CCCCC(C)C)[C@@H](O)[C@H](O)[C@@H](CO)O[C@]1(C(=O)CCCCC(C)C)[C@@]1(O)[C@@H](CO)O[C@](O)(CO)[C@H]1O |
| InChI | InChI=1S/C36H64O14/c1-22(2)13-7-10-16-26(40)35(50-29(42)18-12-9-15-24(5)6)31(44)30(43)25(19-37)48-36(35,27(41)17-11-8-14-23(3)4)34(47)28(20-38)49-33(46,21-39)32(34)45/h22-25,28,30-32,37-39,43-47H,7-21H2,1-6H3/t25-,28-,30-,31+,32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | CURRUAOVVGNQDI-DKVXXXRLSA-N |
| XLogP | 1.07 |
| TPSA | 240.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.89 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|