C20H13Br2N3O2 — CID 91543249
4-(3,5-dibromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile (PubChem CID 91543249) has the molecular formula C20H13Br2N3O2 and a molecular weight of 487.15 g/mol. Its IUPAC name is 4-(3,5-dibromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile.
| Compound Name | 4-(3,5-dibromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 91543249 |
| Molecular Formula | C20H13Br2N3O2 |
| Molecular Weight | 487.15 g/mol |
| Exact Mass | 484.94 |
| IUPAC Name | 4-(3,5-dibromophenyl)-2-imino-6-methyl-5-oxo-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(c(=O)n(C)c3ccccc23)C(c2cc(Br)cc(Br)c2)C1C#N |
| InChI | InChI=1S/C20H13Br2N3O2/c1-25-15-5-3-2-4-13(15)18-17(20(25)26)16(14(9-23)19(24)27-18)10-6-11(21)8-12(22)7-10/h2-8,14,16,24H,1H3/b24-19- |
| InChIKey | XEUKPIIBGVPWKD-CLCOLTQESA-N |
| XLogP | 4.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.15 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|