About ethane;1-fluoro-3-methylbenzene;tetrachloromethane
ethane;1-fluoro-3-methylbenzene;tetrachloromethane (PubChem CID 91543294) has the molecular formula C10H13Cl4F
and a molecular weight of 294.02 g/mol. Its IUPAC name is ethane;1-fluoro-3-methylbenzene;tetrachloromethane.
Molecular Properties
| Compound Name | ethane;1-fluoro-3-methylbenzene;tetrachloromethane |
| PubChem CID | 91543294 |
| Molecular Formula | C10H13Cl4F |
| Molecular Weight | 294.02 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | ethane;1-fluoro-3-methylbenzene;tetrachloromethane |
| SMILES | CC.Cc1cccc(F)c1.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H7F.C2H6.CCl4/c1-6-3-2-4-7(8)5-6;1-2;2-1(3,4)5/h2-5H,1H3;1-2H3; |
| InChIKey | FNZKGUJTQDMNCV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.02 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-fluoro-3-methylbenzene;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-3-methylbenzene;tetrachloromethane?
The IUPAC name of ethane;1-fluoro-3-methylbenzene;tetrachloromethane (CID 91543294) is ethane;1-fluoro-3-methylbenzene;tetrachloromethane.
What is the SMILES notation for ethane;1-fluoro-3-methylbenzene;tetrachloromethane?
The canonical SMILES for ethane;1-fluoro-3-methylbenzene;tetrachloromethane is CC.Cc1cccc(F)c1.ClC(Cl)(Cl)Cl.
What is the InChIKey of ethane;1-fluoro-3-methylbenzene;tetrachloromethane?
The InChIKey is FNZKGUJTQDMNCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C2H6.CCl4/c1-6-3-2-4-7(8)5-6;1-2;2-1(3,4)5/h2-5H,1H3;1-2H3;.
What are the key properties of ethane;1-fluoro-3-methylbenzene;tetrachloromethane?
ethane;1-fluoro-3-methylbenzene;tetrachloromethane has a molecular weight of 294.02 g/mol, XLogP of 5.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-3-methylbenzene;tetrachloromethane is sourced from PubChem (CID 91543294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).