C32H49NO4 — CID 91543319
(2,5-dihydroxypyrrol-1-yl) (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 91543319) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 91543319 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(C(=O)On5c(O)ccc5O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H49NO4/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-23-19-22(30(36)37-33-28(34)13-14-29(33)35)15-17-31(23,4)27(24)16-18-32(25,26)5/h9,13-14,20-22,24-27,34-35H,6-8,10-12,15-19H2,1-5H3/t21-,22?,24?,25-,26?,27?,31+,32-/m1/s1 |
| InChIKey | CYIGFHMYTNEWLU-ACSLLUBHSA-N |
| XLogP | 7.51 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|