About ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one
ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 91543375) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 91543375 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | CC.Cc1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C10H9NO2.C2H6/c1-7-9(11-13-10(7)12)8-5-3-2-4-6-8;1-2/h2-6,11H,1H3;1-2H3 |
| InChIKey | YYJFVZOIHJXBMC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one?
The IUPAC name of ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one (CID 91543375) is ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one is CC.Cc1c(-c2ccccc2)[nH]oc1=O.
What is the InChIKey of ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one?
The InChIKey is YYJFVZOIHJXBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2.C2H6/c1-7-9(11-13-10(7)12)8-5-3-2-4-6-8;1-2/h2-6,11H,1H3;1-2H3.
What are the key properties of ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one?
ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one has a molecular weight of 205.26 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-3-phenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 91543375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).