C11H12O5S — CID 91543720
6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-sulfonic acid (PubChem CID 91543720) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-sulfonic acid.
| Compound Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-sulfonic acid |
|---|---|
| PubChem CID | 91543720 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 6-(cyclohexa-1,3-dien-1-ylmethyl)-1,4-dioxine-2-sulfonic acid |
| SMILES | O=S(=O)(O)C1=COC=C(CC2=CC=CCC2)O1 |
| InChI | InChI=1S/C11H12O5S/c12-17(13,14)11-8-15-7-10(16-11)6-9-4-2-1-3-5-9/h1-2,4,7-8H,3,5-6H2,(H,12,13,14) |
| InChIKey | HMFYWFWDMLFMTN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|