About N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine
N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine (PubChem CID 91543836) has the molecular formula C20H43NO
and a molecular weight of 313.57 g/mol. Its IUPAC name is N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine |
| PubChem CID | 91543836 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine |
| SMILES | CCC(C)NC(C)C(C)C(C)CCCCOC(C)(CC)CC |
| InChI | InChI=1S/C20H43NO/c1-9-17(5)21-19(7)18(6)16(4)14-12-13-15-22-20(8,10-2)11-3/h16-19,21H,9-15H2,1-8H3 |
| InChIKey | DFPKLUPJSBSJCY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine?
The IUPAC name of N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine (CID 91543836) is N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine.
What is the SMILES notation for N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine?
The canonical SMILES for N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine is CCC(C)NC(C)C(C)C(C)CCCCOC(C)(CC)CC.
What is the InChIKey of N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine?
The InChIKey is DFPKLUPJSBSJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43NO/c1-9-17(5)21-19(7)18(6)16(4)14-12-13-15-22-20(8,10-2)11-3/h16-19,21H,9-15H2,1-8H3.
What are the key properties of N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine?
N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine has a molecular weight of 313.57 g/mol, XLogP of 5.80, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3,4-dimethyl-8-(3-methylpentan-3-yloxy)octan-2-amine is sourced from PubChem (CID 91543836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).