C11H8F3NO4 — CID 91544062
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2,2,2-trifluoroacetate (PubChem CID 91544062) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2,2,2-trifluoroacetate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91544062 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2,2,2-trifluoroacetate |
| SMILES | O=C(On1c(O)c2c(c1O)C1C=CC2C1)C(F)(F)F |
| InChI | InChI=1S/C11H8F3NO4/c12-11(13,14)10(18)19-15-8(16)6-4-1-2-5(3-4)7(6)9(15)17/h1-2,4-5,16-17H,3H2 |
| InChIKey | GOTSNYBMVVGKCH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|