C21H28O3 — CID 91544285
methyl 3-methyl-7-[3-(2,6,6-trimethylcyclohexen-1-yl)oxiren-2-yl]octa-2,4,6-trienoate (PubChem CID 91544285) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is methyl 3-methyl-7-[3-(2,6,6-trimethylcyclohexen-1-yl)oxiren-2-yl]octa-2,4,6-trienoate.
| Compound Name | methyl 3-methyl-7-[3-(2,6,6-trimethylcyclohexen-1-yl)oxiren-2-yl]octa-2,4,6-trienoate |
|---|---|
| PubChem CID | 91544285 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | methyl 3-methyl-7-[3-(2,6,6-trimethylcyclohexen-1-yl)oxiren-2-yl]octa-2,4,6-trienoate |
| SMILES | COC(=O)C=C(C)C=CC=C(C)C1=C(C2=C(C)CCCC2(C)C)O1 |
| InChI | InChI=1S/C21H28O3/c1-14(13-17(22)23-6)9-7-10-16(3)19-20(24-19)18-15(2)11-8-12-21(18,4)5/h7,9-10,13H,8,11-12H2,1-6H3 |
| InChIKey | WZTHHIQPIKYKKI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|