About thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate
thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate (PubChem CID 91544459) has the molecular formula C21H24N4O2S
and a molecular weight of 396.52 g/mol. Its IUPAC name is thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate.
Molecular Properties
| Compound Name | thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate |
| PubChem CID | 91544459 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(N(C(=O)Oc2ncnc3ccsc23)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-15(2)16-6-8-17(9-7-16)25(24-11-4-3-5-12-24)21(26)27-20-19-18(10-13-28-19)22-14-23-20/h6-10,13-15H,3-5,11-12H2,1-2H3 |
| InChIKey | HNXXQRDLNGUOJS-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate?
The IUPAC name of thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate (CID 91544459) is thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate.
What is the SMILES notation for thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate?
The canonical SMILES for thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate is CC(C)c1ccc(N(C(=O)Oc2ncnc3ccsc23)N2CCCCC2)cc1.
What is the InChIKey of thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate?
The InChIKey is HNXXQRDLNGUOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O2S/c1-15(2)16-6-8-17(9-7-16)25(24-11-4-3-5-12-24)21(26)27-20-19-18(10-13-28-19)22-14-23-20/h6-10,13-15H,3-5,11-12H2,1-2H3.
What are the key properties of thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate?
thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate has a molecular weight of 396.52 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-d]pyrimidin-4-yl N-piperidin-1-yl-N-(4-propan-2-ylphenyl)carbamate is sourced from PubChem (CID 91544459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).