About [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate
[3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate (PubChem CID 91544474) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate |
| PubChem CID | 91544474 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCC=C(c2c[nH]c3cccnc23)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-18(2,3)21-17(22)23-13-7-4-6-12(10-13)14-11-20-15-8-5-9-19-16(14)15/h5-6,8-9,11,13,20H,4,7,10H2,1-3H3,(H,21,22) |
| InChIKey | VRXFSMFAHLVAKH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate?
The IUPAC name of [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate (CID 91544474) is [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate.
What is the SMILES notation for [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate?
The canonical SMILES for [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCC=C(c2c[nH]c3cccnc23)C1.
What is the InChIKey of [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate?
The InChIKey is VRXFSMFAHLVAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-18(2,3)21-17(22)23-13-7-4-6-12(10-13)14-11-20-15-8-5-9-19-16(14)15/h5-6,8-9,11,13,20H,4,7,10H2,1-3H3,(H,21,22).
What are the key properties of [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate?
[3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate has a molecular weight of 313.40 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohex-3-en-1-yl] N-tert-butylcarbamate is sourced from PubChem (CID 91544474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).