C39H69O11P — CID 91544825
[(2R)-2-hexadeca-5,11-dienoyloxy-3-[hydroxy-[(2R,3R)-2,3,4-trihydroxybutoxy]phosphoryl]oxypropyl] hexadeca-5,11-dienoate (PubChem CID 91544825) has the molecular formula C39H69O11P and a molecular weight of 744.94 g/mol. Its IUPAC name is [(2R)-2-hexadeca-5,11-dienoyloxy-3-[hydroxy-[(2R,3R)-2,3,4-trihydroxybutoxy]phosphoryl]oxypropyl] hexadeca-5,11-dienoate.
| Compound Name | [(2R)-2-hexadeca-5,11-dienoyloxy-3-[hydroxy-[(2R,3R)-2,3,4-trihydroxybutoxy]phosphoryl]oxypropyl] hexadeca-5,11-dienoate |
|---|---|
| PubChem CID | 91544825 |
| Molecular Formula | C39H69O11P |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.46 |
| IUPAC Name | [(2R)-2-hexadeca-5,11-dienoyloxy-3-[hydroxy-[(2R,3R)-2,3,4-trihydroxybutoxy]phosphoryl]oxypropyl] hexadeca-5,11-dienoate |
| SMILES | CCCCC=CCCCCC=CCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)[C@H](O)CO)OC(=O)CCCC=CCCCCC=CCCCC |
| InChI | InChI=1S/C39H69O11P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-38(43)47-32-35(33-48-51(45,46)49-34-37(42)36(41)31-40)50-39(44)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h9-12,21-24,35-37,40-42H,3-8,13-20,25-34H2,1-2H3,(H,45,46)/t35-,36-,37-/m1/s1 |
| InChIKey | BIUICZCWLFTBAE-KESADLGGSA-N |
| XLogP | 8.36 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|