C8H7F3N4 — CID 91544987
2-(1H-pyrazol-5-ylmethyl)-5-(trifluoromethyl)-1H-imidazole (PubChem CID 91544987) has the molecular formula C8H7F3N4 and a molecular weight of 216.17 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-ylmethyl)-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-(1H-pyrazol-5-ylmethyl)-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 91544987 |
| Molecular Formula | C8H7F3N4 |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(1H-pyrazol-5-ylmethyl)-5-(trifluoromethyl)-1H-imidazole |
| SMILES | FC(F)(F)c1cnc(Cc2ccn[nH]2)[nH]1 |
| InChI | InChI=1S/C8H7F3N4/c9-8(10,11)6-4-12-7(14-6)3-5-1-2-13-15-5/h1-2,4H,3H2,(H,12,14)(H,13,15) |
| InChIKey | QKVPHOLQHZTLCQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |